C9H11NO3 — CID 131182312
[(3S)-6-amino-2,3-dihydro-1,4-benzodioxin-3-yl]methanol (PubChem CID 131182312) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is [(3S)-6-amino-2,3-dihydro-1,4-benzodioxin-3-yl]methanol.
| Compound Name | [(3S)-6-amino-2,3-dihydro-1,4-benzodioxin-3-yl]methanol |
|---|---|
| PubChem CID | 131182312 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | [(3S)-6-amino-2,3-dihydro-1,4-benzodioxin-3-yl]methanol |
| SMILES | Nc1ccc2c(c1)O[C@@H](CO)CO2 |
| InChI | InChI=1S/C9H11NO3/c10-6-1-2-8-9(3-6)13-7(4-11)5-12-8/h1-3,7,11H,4-5,10H2/t7-/m0/s1 |
| InChIKey | WESGTRBLNOIOAT-ZETCQYMHSA-N |
| XLogP | 0.40 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|