C9H12N2O3 — CID 89334694
[(2S)-6-hydrazinyl-2,3-dihydro-1,4-benzodioxin-2-yl]methanol (PubChem CID 89334694) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is [(2S)-6-hydrazinyl-2,3-dihydro-1,4-benzodioxin-2-yl]methanol.
| Compound Name | [(2S)-6-hydrazinyl-2,3-dihydro-1,4-benzodioxin-2-yl]methanol |
|---|---|
| PubChem CID | 89334694 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | [(2S)-6-hydrazinyl-2,3-dihydro-1,4-benzodioxin-2-yl]methanol |
| SMILES | NNc1ccc2c(c1)OC[C@H](CO)O2 |
| InChI | InChI=1S/C9H12N2O3/c10-11-6-1-2-8-9(3-6)13-5-7(4-12)14-8/h1-3,7,11-12H,4-5,10H2/t7-/m0/s1 |
| InChIKey | OJYKRRYLIPTSAY-ZETCQYMHSA-N |
| XLogP | 0.10 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|