C10H13NO2 — CID 105438030
(6-amino-3,4-dihydro-2H-chromen-3-yl)methanol (PubChem CID 105438030) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol.
| Compound Name | (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol |
|---|---|
| PubChem CID | 105438030 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol |
| SMILES | Nc1ccc2c(c1)CC(CO)CO2 |
| InChI | InChI=1S/C10H13NO2/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-2,4,7,12H,3,5-6,11H2 |
| InChIKey | GHAUXRIFSQFKGL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|