About (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol
(6-amino-3,4-dihydro-2H-chromen-3-yl)methanol (PubChem CID 105438030) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol.
Molecular Properties
| Compound Name | (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol |
| PubChem CID | 105438030 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol |
| SMILES | Nc1ccc2c(c1)CC(CO)CO2 |
| InChI | InChI=1S/C10H13NO2/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-2,4,7,12H,3,5-6,11H2 |
| InChIKey | GHAUXRIFSQFKGL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol?
The IUPAC name of (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol (CID 105438030) is (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol.
What is the SMILES notation for (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol?
The canonical SMILES for (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol is Nc1ccc2c(c1)CC(CO)CO2.
What is the InChIKey of (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol?
The InChIKey is GHAUXRIFSQFKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-2,4,7,12H,3,5-6,11H2.
What are the key properties of (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol?
(6-amino-3,4-dihydro-2H-chromen-3-yl)methanol has a molecular weight of 179.22 g/mol, XLogP of 0.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-3,4-dihydro-2H-chromen-3-yl)methanol is sourced from PubChem (CID 105438030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).