C13H18N2O2 — CID 143961796
(3-amino-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-9-yl)methanol (PubChem CID 143961796) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3-amino-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-9-yl)methanol.
| Compound Name | (3-amino-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-9-yl)methanol |
|---|---|
| PubChem CID | 143961796 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (3-amino-6,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzoxazin-9-yl)methanol |
| SMILES | Nc1ccc2c(c1)OCC1CCC(CO)CN21 |
| InChI | InChI=1S/C13H18N2O2/c14-10-2-4-12-13(5-10)17-8-11-3-1-9(7-16)6-15(11)12/h2,4-5,9,11,16H,1,3,6-8,14H2 |
| InChIKey | YLRVNAIGZKXMPH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|