C12H14N2O2 — CID 82285435
(7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-cyclopropylmethanone (PubChem CID 82285435) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-cyclopropylmethanone.
| Compound Name | (7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-cyclopropylmethanone |
|---|---|
| PubChem CID | 82285435 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (7-amino-2,3-dihydro-1,4-benzoxazin-4-yl)-cyclopropylmethanone |
| SMILES | Nc1ccc2c(c1)OCCN2C(=O)C1CC1 |
| InChI | InChI=1S/C12H14N2O2/c13-9-3-4-10-11(7-9)16-6-5-14(10)12(15)8-1-2-8/h3-4,7-8H,1-2,5-6,13H2 |
| InChIKey | GFFXHASWYXDJNI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|