C20H27N3O3 — CID 95782757
cyclopropyl-[(3S)-3-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidin-1-yl]methanone (PubChem CID 95782757) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is cyclopropyl-[(3S)-3-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(3S)-3-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95782757 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | cyclopropyl-[(3S)-3-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazine-4-carbonyl]piperidin-1-yl]methanone |
| SMILES | CN(C)c1ccc2c(c1)OCCN2C(=O)[C@H]1CCCN(C(=O)C2CC2)C1 |
| InChI | InChI=1S/C20H27N3O3/c1-21(2)16-7-8-17-18(12-16)26-11-10-23(17)20(25)15-4-3-9-22(13-15)19(24)14-5-6-14/h7-8,12,14-15H,3-6,9-11,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | ONKYBNLUVHVHRV-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|