C16H22N2O4S2 — CID 95782754
1-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylethanone (PubChem CID 95782754) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylethanone.
| Compound Name | 1-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 95782754 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 1-[7-(dimethylamino)-2,3-dihydro-1,4-benzoxazin-4-yl]-2-[(3R)-1,1-dioxothiolan-3-yl]sulfanylethanone |
| SMILES | CN(C)c1ccc2c(c1)OCCN2C(=O)CS[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H22N2O4S2/c1-17(2)12-3-4-14-15(9-12)22-7-6-18(14)16(19)10-23-13-5-8-24(20,21)11-13/h3-4,9,13H,5-8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | VFAVTFSJSNZQPO-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|