C13H23NO3S2 — CID 95572289
1-(azocan-1-yl)-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylethanone (PubChem CID 95572289) has the molecular formula C13H23NO3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 1-(azocan-1-yl)-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylethanone.
| Compound Name | 1-(azocan-1-yl)-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 95572289 |
| Molecular Formula | C13H23NO3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-(azocan-1-yl)-2-[(3S)-1,1-dioxothiolan-3-yl]sulfanylethanone |
| SMILES | O=C(CS[C@H]1CCS(=O)(=O)C1)N1CCCCCCC1 |
| InChI | InChI=1S/C13H23NO3S2/c15-13(14-7-4-2-1-3-5-8-14)10-18-12-6-9-19(16,17)11-12/h12H,1-11H2/t12-/m0/s1 |
| InChIKey | GWTAXUKEPGKGEU-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |