C6H9O4S2- — CID 3094616
2-(1,1-dioxothiolan-3-yl)sulfanylacetate (PubChem CID 3094616) has the molecular formula C6H9O4S2- and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfanylacetate.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 3094616 |
| Molecular Formula | C6H9O4S2- |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfanylacetate |
| SMILES | O=C([O-])CSC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H10O4S2/c7-6(8)3-11-5-1-2-12(9,10)4-5/h5H,1-4H2,(H,7,8)/p-1 |
| InChIKey | AJTOTGKRRDVGAK-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |