C10H19NO3S2 — CID 60666980
N-tert-butyl-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide (PubChem CID 60666980) has the molecular formula C10H19NO3S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-tert-butyl-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide.
| Compound Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 60666980 |
| Molecular Formula | C10H19NO3S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | N-tert-butyl-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide |
| SMILES | CC(C)(C)NC(=O)CSC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO3S2/c1-10(2,3)11-9(12)6-15-8-4-5-16(13,14)7-8/h8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | MSPXFGKMLZAFSZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |