C7H10N2O3S2 — CID 79194937
N-cyano-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide (PubChem CID 79194937) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-cyano-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide.
| Compound Name | N-cyano-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 79194937 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | N-cyano-2-(1,1-dioxothiolan-3-yl)sulfanylacetamide |
| SMILES | N#CNC(=O)CSC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C7H10N2O3S2/c8-5-9-7(10)3-13-6-1-2-14(11,12)4-6/h6H,1-4H2,(H,9,10) |
| InChIKey | PEKPEXFYHUQUAV-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|