C11H19NO3S2 — CID 18777901
2-cyclopentylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 18777901) has the molecular formula C11H19NO3S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 18777901 |
| Molecular Formula | C11H19NO3S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | O=C(CSC1CCCC1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO3S2/c13-11(7-16-10-3-1-2-4-10)12-9-5-6-17(14,15)8-9/h9-10H,1-8H2,(H,12,13) |
| InChIKey | MIRFIFBRSJAWGD-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |