C9H17NO5S2 — CID 79676127
2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-methoxyethoxy)acetamide (PubChem CID 79676127) has the molecular formula C9H17NO5S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-methoxyethoxy)acetamide.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 79676127 |
| Molecular Formula | C9H17NO5S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)sulfanyl-N-(2-methoxyethoxy)acetamide |
| SMILES | COCCONC(=O)CSC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO5S2/c1-14-3-4-15-10-9(11)6-16-8-2-5-17(12,13)7-8/h8H,2-7H2,1H3,(H,10,11) |
| InChIKey | DYSWEWRJVZUDEE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|