C8H14O4S2 — CID 78912204
ethyl 2-(1,1-dioxothiolan-3-yl)sulfanylacetate (PubChem CID 78912204) has the molecular formula C8H14O4S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethyl 2-(1,1-dioxothiolan-3-yl)sulfanylacetate.
| Compound Name | ethyl 2-(1,1-dioxothiolan-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 78912204 |
| Molecular Formula | C8H14O4S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | ethyl 2-(1,1-dioxothiolan-3-yl)sulfanylacetate |
| SMILES | CCOC(=O)CSC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14O4S2/c1-2-12-8(9)5-13-7-3-4-14(10,11)6-7/h7H,2-6H2,1H3 |
| InChIKey | FMXXXZVBDAJEFB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |