C11H16N2O — CID 83853025
3,4-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-7-amine (PubChem CID 83853025) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 3,4-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-7-amine.
| Compound Name | 3,4-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-7-amine |
|---|---|
| PubChem CID | 83853025 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 3,4-dimethyl-3,5-dihydro-2H-1,4-benzoxazepin-7-amine |
| SMILES | CC1COc2ccc(N)cc2CN1C |
| InChI | InChI=1S/C11H16N2O/c1-8-7-14-11-4-3-10(12)5-9(11)6-13(8)2/h3-5,8H,6-7,12H2,1-2H3 |
| InChIKey | XIRWEVJPTJXPIG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|