C10H12N2O2 — CID 43209471
6-amino-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 43209471) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 6-amino-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | 6-amino-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 43209471 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 6-amino-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | NC(=O)C1COc2ccc(N)cc2C1 |
| InChI | InChI=1S/C10H12N2O2/c11-8-1-2-9-6(4-8)3-7(5-14-9)10(12)13/h1-2,4,7H,3,5,11H2,(H2,12,13) |
| InChIKey | LLYYVMYKPNKHFH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|