C14H16N2O2 — CID 132569005
1,2,3,5,6,7-hexahydro-s-indacene-2,6-dicarboxamide (PubChem CID 132569005) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydro-s-indacene-2,6-dicarboxamide.
| Compound Name | 1,2,3,5,6,7-hexahydro-s-indacene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 132569005 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1,2,3,5,6,7-hexahydro-s-indacene-2,6-dicarboxamide |
| SMILES | NC(=O)C1Cc2cc3c(cc2C1)CC(C(N)=O)C3 |
| InChI | InChI=1S/C14H16N2O2/c15-13(17)11-3-7-1-8-4-12(14(16)18)6-10(8)2-9(7)5-11/h1-2,11-12H,3-6H2,(H2,15,17)(H2,16,18) |
| InChIKey | PYZHCNDYXMTMDW-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |