C10H12FNO — CID 96628424
[(3S)-6-fluoro-3,4-dihydro-2H-chromen-3-yl]methanamine (PubChem CID 96628424) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is [(3S)-6-fluoro-3,4-dihydro-2H-chromen-3-yl]methanamine.
| Compound Name | [(3S)-6-fluoro-3,4-dihydro-2H-chromen-3-yl]methanamine |
|---|---|
| PubChem CID | 96628424 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [(3S)-6-fluoro-3,4-dihydro-2H-chromen-3-yl]methanamine |
| SMILES | NC[C@H]1COc2ccc(F)cc2C1 |
| InChI | InChI=1S/C10H12FNO/c11-9-1-2-10-8(4-9)3-7(5-12)6-13-10/h1-2,4,7H,3,5-6,12H2/t7-/m0/s1 |
| InChIKey | ZYOVOLVNERRAJQ-ZETCQYMHSA-N |
| XLogP | 1.34 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |