C9H8FNO3 — CID 55268431
6-fluoro-3-nitro-3,4-dihydro-2H-chromene (PubChem CID 55268431) has the molecular formula C9H8FNO3 and a molecular weight of 197.17 g/mol. Its IUPAC name is 6-fluoro-3-nitro-3,4-dihydro-2H-chromene.
| Compound Name | 6-fluoro-3-nitro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 55268431 |
| Molecular Formula | C9H8FNO3 |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 6-fluoro-3-nitro-3,4-dihydro-2H-chromene |
| SMILES | O=[N+]([O-])C1COc2ccc(F)cc2C1 |
| InChI | InChI=1S/C9H8FNO3/c10-7-1-2-9-6(3-7)4-8(5-14-9)11(12)13/h1-3,8H,4-5H2 |
| InChIKey | QUSIOVNJDVXBOM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|