C14H15FN2O3 — CID 154799491
3-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 154799491) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154799491 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(6-fluoro-3,4-dihydro-2H-chromen-3-yl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)NC(=O)N(C2COc3ccc(F)cc3C2)C1=O |
| InChI | InChI=1S/C14H15FN2O3/c1-14(2)12(18)17(13(19)16-14)10-6-8-5-9(15)3-4-11(8)20-7-10/h3-5,10H,6-7H2,1-2H3,(H,16,19) |
| InChIKey | JIIXSQIQSGUYSP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|