C9H9FN2O2 — CID 142795120
2-amino-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 142795120) has the molecular formula C9H9FN2O2 and a molecular weight of 196.18 g/mol. Its IUPAC name is 2-amino-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 2-amino-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 142795120 |
| Molecular Formula | C9H9FN2O2 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 2-amino-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | NC1CC(=O)Nc2cc(F)ccc2O1 |
| InChI | InChI=1S/C9H9FN2O2/c10-5-1-2-7-6(3-5)12-9(13)4-8(11)14-7/h1-3,8H,4,11H2,(H,12,13) |
| InChIKey | ISCIOONFJFMMRH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |