C7H7FN2O — CID 164602655
5-fluoro-2,3-dihydro-1,3-benzoxazol-2-amine (PubChem CID 164602655) has the molecular formula C7H7FN2O and a molecular weight of 154.14 g/mol. Its IUPAC name is 5-fluoro-2,3-dihydro-1,3-benzoxazol-2-amine.
| Compound Name | 5-fluoro-2,3-dihydro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 164602655 |
| Molecular Formula | C7H7FN2O |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 5-fluoro-2,3-dihydro-1,3-benzoxazol-2-amine |
| SMILES | NC1Nc2cc(F)ccc2O1 |
| InChI | InChI=1S/C7H7FN2O/c8-4-1-2-6-5(3-4)10-7(9)11-6/h1-3,7,10H,9H2 |
| InChIKey | ZKBQMCFKASTBIH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |