C8H8N2O3 — CID 142117161
2-amino-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid (PubChem CID 142117161) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-amino-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-amino-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 142117161 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-amino-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid |
| SMILES | NC1Nc2cc(C(=O)O)ccc2O1 |
| InChI | InChI=1S/C8H8N2O3/c9-8-10-5-3-4(7(11)12)1-2-6(5)13-8/h1-3,8,10H,9H2,(H,11,12) |
| InChIKey | MXNFRZNBLGWYKH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |