C8H7NO3S — CID 163469810
2-sulfanyl-2,3-dihydro-1,3-benzoxazole-6-carboxylic acid (PubChem CID 163469810) has the molecular formula C8H7NO3S and a molecular weight of 197.22 g/mol. Its IUPAC name is 2-sulfanyl-2,3-dihydro-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-sulfanyl-2,3-dihydro-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 163469810 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 2-sulfanyl-2,3-dihydro-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)OC(S)N2 |
| InChI | InChI=1S/C8H7NO3S/c10-7(11)4-1-2-5-6(3-4)12-8(13)9-5/h1-3,8-9,13H,(H,10,11) |
| InChIKey | BVQBIUGYPPGFEF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|