C10H9NO4 — CID 115096140
3-methyl-2-oxo-3,4-dihydro-1,4-benzoxazine-7-carboxylic acid (PubChem CID 115096140) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-methyl-2-oxo-3,4-dihydro-1,4-benzoxazine-7-carboxylic acid.
| Compound Name | 3-methyl-2-oxo-3,4-dihydro-1,4-benzoxazine-7-carboxylic acid |
|---|---|
| PubChem CID | 115096140 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-methyl-2-oxo-3,4-dihydro-1,4-benzoxazine-7-carboxylic acid |
| SMILES | CC1Nc2ccc(C(=O)O)cc2OC1=O |
| InChI | InChI=1S/C10H9NO4/c1-5-10(14)15-8-4-6(9(12)13)2-3-7(8)11-5/h2-5,11H,1H3,(H,12,13) |
| InChIKey | UXNRGOFWUSNTAU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|