About 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid
3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (PubChem CID 84628137) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid.
Analyze 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid?
The IUPAC name of 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (CID 84628137) is 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid.
What is the SMILES notation for 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid?
The canonical SMILES for 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid is CC(C)(C)C1COc2cc(C(=O)O)ccc2N1.
What is the InChIKey of 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid?
The InChIKey is CJVZKJPKGZGVCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-13(2,3)11-7-17-10-6-8(12(15)16)4-5-9(10)14-11/h4-6,11,14H,7H2,1-3H3,(H,15,16).
What are the key properties of 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid?
3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid has a molecular weight of 235.28 g/mol, XLogP of 2.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid is sourced from PubChem (CID 84628137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).