About (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine
(3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 1479591) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 1479591 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)N[C@@H](C(C)(C)C)CO2 |
| InChI | InChI=1S/C13H19NO/c1-9-5-6-11-10(7-9)14-12(8-15-11)13(2,3)4/h5-7,12,14H,8H2,1-4H3/t12-/m1/s1 |
| InChIKey | KACIGXXYHOZGNQ-GFCCVEGCSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 1479591) is (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine is Cc1ccc2c(c1)N[C@@H](C(C)(C)C)CO2.
What is the InChIKey of (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is KACIGXXYHOZGNQ-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H19NO/c1-9-5-6-11-10(7-9)14-12(8-15-11)13(2,3)4/h5-7,12,14H,8H2,1-4H3/t12-/m1/s1.
What are the key properties of (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine?
(3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 205.30 g/mol, XLogP of 3.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-tert-butyl-6-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 1479591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).