C11H12O2 — CID 117201759
1-(5-methyl-2,3-dihydro-1-benzofuran-3-yl)ethanone (PubChem CID 117201759) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(5-methyl-2,3-dihydro-1-benzofuran-3-yl)ethanone.
| Compound Name | 1-(5-methyl-2,3-dihydro-1-benzofuran-3-yl)ethanone |
|---|---|
| PubChem CID | 117201759 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-(5-methyl-2,3-dihydro-1-benzofuran-3-yl)ethanone |
| SMILES | CC(=O)C1COc2ccc(C)cc21 |
| InChI | InChI=1S/C11H12O2/c1-7-3-4-11-9(5-7)10(6-13-11)8(2)12/h3-5,10H,6H2,1-2H3 |
| InChIKey | WAVVVLHFLQSJMK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |