C12H12O5 — CID 102597094
(7-methyl-4-oxo-2,3-dihydro-1,5-benzodioxepin-3-yl) acetate (PubChem CID 102597094) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is (7-methyl-4-oxo-2,3-dihydro-1,5-benzodioxepin-3-yl) acetate.
| Compound Name | (7-methyl-4-oxo-2,3-dihydro-1,5-benzodioxepin-3-yl) acetate |
|---|---|
| PubChem CID | 102597094 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (7-methyl-4-oxo-2,3-dihydro-1,5-benzodioxepin-3-yl) acetate |
| SMILES | CC(=O)OC1COc2ccc(C)cc2OC1=O |
| InChI | InChI=1S/C12H12O5/c1-7-3-4-9-10(5-7)17-12(14)11(6-15-9)16-8(2)13/h3-5,11H,6H2,1-2H3 |
| InChIKey | CPXYCNXMNYRDEQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|