C10H10O4 — CID 129391816
[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl] acetate (PubChem CID 129391816) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl] acetate.
| Compound Name | [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl] acetate |
|---|---|
| PubChem CID | 129391816 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | [(3R)-2,3-dihydro-1,4-benzodioxin-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C10H10O4/c1-7(11)13-10-6-12-8-4-2-3-5-9(8)14-10/h2-5,10H,6H2,1H3/t10-/m0/s1 |
| InChIKey | UVHWHUIRPILQMZ-JTQLQIEISA-N |
| XLogP | 1.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |