About (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine
(3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 94977042) has the molecular formula C9H10BrNO
and a molecular weight of 228.09 g/mol. Its IUPAC name is (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 94977042 |
| Molecular Formula | C9H10BrNO |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | C[C@H]1COc2ccc(Br)cc2N1 |
| InChI | InChI=1S/C9H10BrNO/c1-6-5-12-9-3-2-7(10)4-8(9)11-6/h2-4,6,11H,5H2,1H3/t6-/m0/s1 |
| InChIKey | DAMUKFVLKNTFNK-LURJTMIESA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine (CID 94977042) is (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine is C[C@H]1COc2ccc(Br)cc2N1.
What is the InChIKey of (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is DAMUKFVLKNTFNK-LURJTMIESA-N. The full InChI is InChI=1S/C9H10BrNO/c1-6-5-12-9-3-2-7(10)4-8(9)11-6/h2-4,6,11H,5H2,1H3/t6-/m0/s1.
What are the key properties of (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine?
(3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 228.09 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-bromo-3-methyl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 94977042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).