C15H12BrNO3 — CID 116837297
3-(1,3-benzodioxol-5-yl)-6-bromo-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837297) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6-bromo-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6-bromo-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116837297 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6-bromo-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Brc1ccc2c(c1)NC(c1ccc3c(c1)OCO3)CO2 |
| InChI | InChI=1S/C15H12BrNO3/c16-10-2-4-13-11(6-10)17-12(7-18-13)9-1-3-14-15(5-9)20-8-19-14/h1-6,12,17H,7-8H2 |
| InChIKey | ZOTMSEOMWIDLNJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |