C14H11BrFNO — CID 116837314
6-bromo-3-(2-fluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837314) has the molecular formula C14H11BrFNO and a molecular weight of 308.15 g/mol. Its IUPAC name is 6-bromo-3-(2-fluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-bromo-3-(2-fluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116837314 |
| Molecular Formula | C14H11BrFNO |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 6-bromo-3-(2-fluorophenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Fc1ccccc1C1COc2ccc(Br)cc2N1 |
| InChI | InChI=1S/C14H11BrFNO/c15-9-5-6-14-12(7-9)17-13(8-18-14)10-3-1-2-4-11(10)16/h1-7,13,17H,8H2 |
| InChIKey | QXVSUNDDJKENAT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |