C16H16BrNO — CID 116837284
6-bromo-3-(3,4-dimethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 116837284) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is 6-bromo-3-(3,4-dimethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6-bromo-3-(3,4-dimethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 116837284 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 6-bromo-3-(3,4-dimethylphenyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1ccc(C2COc3ccc(Br)cc3N2)cc1C |
| InChI | InChI=1S/C16H16BrNO/c1-10-3-4-12(7-11(10)2)15-9-19-16-6-5-13(17)8-14(16)18-15/h3-8,15,18H,9H2,1-2H3 |
| InChIKey | GSRMGCWXLWMRQJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |