C10H10BrNO2 — CID 171184420
(4R)-4-(3-bromo-4-methylphenyl)-1,3-oxazolidin-2-one (PubChem CID 171184420) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is (4R)-4-(3-bromo-4-methylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(3-bromo-4-methylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171184420 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (4R)-4-(3-bromo-4-methylphenyl)-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc([C@@H]2COC(=O)N2)cc1Br |
| InChI | InChI=1S/C10H10BrNO2/c1-6-2-3-7(4-8(6)11)9-5-14-10(13)12-9/h2-4,9H,5H2,1H3,(H,12,13)/t9-/m0/s1 |
| InChIKey | PEPACHFJBKLANV-VIFPVBQESA-N |
| XLogP | 2.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |