C9H9NO4 — CID 130144619
4-(3,4-dihydroxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 130144619) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is 4-(3,4-dihydroxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(3,4-dihydroxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130144619 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 4-(3,4-dihydroxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(c2ccc(O)c(O)c2)CO1 |
| InChI | InChI=1S/C9H9NO4/c11-7-2-1-5(3-8(7)12)6-4-14-9(13)10-6/h1-3,6,11-12H,4H2,(H,10,13) |
| InChIKey | UQFKQEKOELBDAL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|