C11H13NO4 — CID 130067438
(4S)-4-(3-ethoxy-4-hydroxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 130067438) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (4S)-4-(3-ethoxy-4-hydroxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(3-ethoxy-4-hydroxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130067438 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (4S)-4-(3-ethoxy-4-hydroxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | CCOc1cc([C@H]2COC(=O)N2)ccc1O |
| InChI | InChI=1S/C11H13NO4/c1-2-15-10-5-7(3-4-9(10)13)8-6-16-11(14)12-8/h3-5,8,13H,2,6H2,1H3,(H,12,14)/t8-/m1/s1 |
| InChIKey | AIOYWYBVZJVKLN-MRVPVSSYSA-N |
| XLogP | 1.57 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |