C12H15BrClNO3 — CID 171185097
(4R)-4-(5-bromo-2-ethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride (PubChem CID 171185097) has the molecular formula C12H15BrClNO3 and a molecular weight of 336.61 g/mol. Its IUPAC name is (4R)-4-(5-bromo-2-ethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride.
| Compound Name | (4R)-4-(5-bromo-2-ethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
|---|---|
| PubChem CID | 171185097 |
| Molecular Formula | C12H15BrClNO3 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | (4R)-4-(5-bromo-2-ethoxyphenyl)-1,3-oxazinan-2-one;hydrochloride |
| SMILES | CCOc1ccc(Br)cc1[C@H]1CCOC(=O)N1.Cl |
| InChI | InChI=1S/C12H14BrNO3.ClH/c1-2-16-11-4-3-8(13)7-9(11)10-5-6-17-12(15)14-10;/h3-4,7,10H,2,5-6H2,1H3,(H,14,15);1H/t10-;/m1./s1 |
| InChIKey | GCROVRZXSNDLET-HNCPQSOCSA-N |
| XLogP | 3.44 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |