About (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride
(4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171184614) has the molecular formula C12H16ClNO4
and a molecular weight of 273.72 g/mol. Its IUPAC name is (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride |
| PubChem CID | 171184614 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | CCOc1cc([C@@H]2COC(=O)N2)ccc1OC.Cl |
| InChI | InChI=1S/C12H15NO4.ClH/c1-3-16-11-6-8(4-5-10(11)15-2)9-7-17-12(14)13-9;/h4-6,9H,3,7H2,1-2H3,(H,13,14);1H/t9-;/m0./s1 |
| InChIKey | QJURNAJLEXVTME-FVGYRXGTSA-N |
| XLogP | 2.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride?
The IUPAC name of (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride (CID 171184614) is (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride.
What is the SMILES notation for (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride?
The canonical SMILES for (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride is CCOc1cc([C@@H]2COC(=O)N2)ccc1OC.Cl.
What is the InChIKey of (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride?
The InChIKey is QJURNAJLEXVTME-FVGYRXGTSA-N. The full InChI is InChI=1S/C12H15NO4.ClH/c1-3-16-11-6-8(4-5-10(11)15-2)9-7-17-12(14)13-9;/h4-6,9H,3,7H2,1-2H3,(H,13,14);1H/t9-;/m0./s1.
What are the key properties of (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride?
(4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride has a molecular weight of 273.72 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-(3-ethoxy-4-methoxyphenyl)-1,3-oxazolidin-2-one;hydrochloride is sourced from PubChem (CID 171184614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).