C17H13NO5 — CID 96544534
(6S)-6-(1,3-benzodioxol-5-yl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one (PubChem CID 96544534) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is (6S)-6-(1,3-benzodioxol-5-yl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one.
| Compound Name | (6S)-6-(1,3-benzodioxol-5-yl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
|---|---|
| PubChem CID | 96544534 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | (6S)-6-(1,3-benzodioxol-5-yl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
| SMILES | O=C1C[C@@H](c2ccc3c(c2)OCO3)Nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H13NO5/c19-13-5-11(9-1-2-14-15(3-9)21-7-20-14)18-12-6-17-16(4-10(12)13)22-8-23-17/h1-4,6,11,18H,5,7-8H2/t11-/m0/s1 |
| InChIKey | IOWVMOVOGIWLFY-NSHDSACASA-N |
| XLogP | 2.88 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|