C18H17NO5 — CID 97045976
(6S)-6-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one (PubChem CID 97045976) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is (6S)-6-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one.
| Compound Name | (6S)-6-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
|---|---|
| PubChem CID | 97045976 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (6S)-6-(3,4-dimethoxyphenyl)-6,7-dihydro-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
| SMILES | COc1ccc([C@@H]2CC(=O)c3cc4c(cc3N2)OCO4)cc1OC |
| InChI | InChI=1S/C18H17NO5/c1-21-15-4-3-10(5-16(15)22-2)12-7-14(20)11-6-17-18(24-9-23-17)8-13(11)19-12/h3-6,8,12,19H,7,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | QTKGDVNPJPWSBD-LBPRGKRZSA-N |
| XLogP | 3.17 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|