C28H24FNO5 — CID 27881359
(7R,10R)-7-(3,4-dimethoxyphenyl)-10-(4-fluorophenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one (PubChem CID 27881359) has the molecular formula C28H24FNO5 and a molecular weight of 473.50 g/mol. Its IUPAC name is (7R,10R)-7-(3,4-dimethoxyphenyl)-10-(4-fluorophenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one.
| Compound Name | (7R,10R)-7-(3,4-dimethoxyphenyl)-10-(4-fluorophenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one |
|---|---|
| PubChem CID | 27881359 |
| Molecular Formula | C28H24FNO5 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | (7R,10R)-7-(3,4-dimethoxyphenyl)-10-(4-fluorophenyl)-6,7,8,10-tetrahydro-5H-[1,3]benzodioxolo[5,6-b]quinolin-9-one |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)Nc2cc4c(cc2[C@H]3c2ccc(F)cc2)OCO4)cc1OC |
| InChI | InChI=1S/C28H24FNO5/c1-32-23-8-5-16(11-24(23)33-2)17-9-21-28(22(31)10-17)27(15-3-6-18(29)7-4-15)19-12-25-26(35-14-34-25)13-20(19)30-21/h3-8,11-13,17,27,30H,9-10,14H2,1-2H3/t17-,27-/m1/s1 |
| InChIKey | WPUNDINSMVEYBN-XGCWNURASA-N |
| XLogP | 5.53 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |