C25H22N4O8 — CID 71950117
7-(3,4-dimethoxyphenyl)-4-(6-nitro-1,3-benzodioxol-5-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 71950117) has the molecular formula C25H22N4O8 and a molecular weight of 506.47 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-4-(6-nitro-1,3-benzodioxol-5-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | 7-(3,4-dimethoxyphenyl)-4-(6-nitro-1,3-benzodioxol-5-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 71950117 |
| Molecular Formula | C25H22N4O8 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-4-(6-nitro-1,3-benzodioxol-5-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)Nc2[nH][nH]c(=O)c2C3c2cc3c(cc2[N+](=O)[O-])OCO3)cc1OC |
| InChI | InChI=1S/C25H22N4O8/c1-34-17-4-3-11(7-18(17)35-2)12-5-14-22(16(30)6-12)21(23-24(26-14)27-28-25(23)31)13-8-19-20(37-10-36-19)9-15(13)29(32)33/h3-4,7-9,12,21H,5-6,10H2,1-2H3,(H3,26,27,28,31) |
| InChIKey | METTWRGFIZYHPH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 157.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|