C25H24N4O7 — CID 71950069
4-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 71950069) has the molecular formula C25H24N4O7 and a molecular weight of 492.49 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | 4-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 71950069 |
| Molecular Formula | C25H24N4O7 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | 4-(3-nitrophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | COc1cc(C2CC(=O)C3=C(C2)Nc2[nH][nH]c(=O)c2C3c2cccc([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O7/c1-34-18-10-14(11-19(35-2)23(18)36-3)13-8-16-21(17(30)9-13)20(22-24(26-16)27-28-25(22)31)12-5-4-6-15(7-12)29(32)33/h4-7,10-11,13,20H,8-9H2,1-3H3,(H3,26,27,28,31) |
| InChIKey | AAEUWEZAYCUBOR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|