C25H24ClN3O5 — CID 71950113
4-(4-chlorophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 71950113) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | 4-(4-chlorophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 71950113 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 4-(4-chlorophenyl)-7-(3,4,5-trimethoxyphenyl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | COc1cc(C2CC(=O)C3=C(C2)Nc2[nH][nH]c(=O)c2C3c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24ClN3O5/c1-32-18-10-14(11-19(33-2)23(18)34-3)13-8-16-21(17(30)9-13)20(12-4-6-15(26)7-5-12)22-24(27-16)28-29-25(22)31/h4-7,10-11,13,20H,8-9H2,1-3H3,(H3,27,28,29,31) |
| InChIKey | JUNQFKCTZPPEME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |