C29H32N2O8 — CID 98122083
2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 98122083) has the molecular formula C29H32N2O8 and a molecular weight of 536.58 g/mol. Its IUPAC name is 2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 98122083 |
| Molecular Formula | C29H32N2O8 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 2-ethoxyethyl (4S,7S)-7-(3,4-dimethoxyphenyl)-2-methyl-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCOCCOC(=O)C1=C(C)NC2=C(C(=O)C[C@@H](c3ccc(OC)c(OC)c3)C2)[C@@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H32N2O8/c1-5-38-11-12-39-29(33)26-17(2)30-22-14-20(18-9-10-24(36-3)25(16-18)37-4)15-23(32)28(22)27(26)19-7-6-8-21(13-19)31(34)35/h6-10,13,16,20,27,30H,5,11-12,14-15H2,1-4H3/t20-,27+/m0/s1 |
| InChIKey | PNRPOMWLOQAZCO-CCLHPLFOSA-N |
| XLogP | 4.55 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|