C21H15NO5 — CID 102388483
7-(1,3-benzodioxol-5-yl)-13,15-dioxa-2-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),3,5,10,12(16)-pentaen-9-one (PubChem CID 102388483) has the molecular formula C21H15NO5 and a molecular weight of 361.35 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-13,15-dioxa-2-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),3,5,10,12(16)-pentaen-9-one.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-13,15-dioxa-2-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),3,5,10,12(16)-pentaen-9-one |
|---|---|
| PubChem CID | 102388483 |
| Molecular Formula | C21H15NO5 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-13,15-dioxa-2-azatetracyclo[8.7.0.02,6.012,16]heptadeca-1(17),3,5,10,12(16)-pentaen-9-one |
| SMILES | O=C1CC(c2ccc3c(c2)OCO3)c2cccn2-c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C21H15NO5/c23-17-7-13(12-3-4-18-19(6-12)25-10-24-18)15-2-1-5-22(15)16-9-21-20(8-14(16)17)26-11-27-21/h1-6,8-9,13H,7,10-11H2 |
| InChIKey | GFWBXWFQTDMGLU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |