C21H16ClNO3 — CID 133179539
7-(4-chlorophenyl)-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-9-one (PubChem CID 133179539) has the molecular formula C21H16ClNO3 and a molecular weight of 365.82 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-9-one.
| Compound Name | 7-(4-chlorophenyl)-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-9-one |
|---|---|
| PubChem CID | 133179539 |
| Molecular Formula | C21H16ClNO3 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 7-(4-chlorophenyl)-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-9-one |
| SMILES | O=C1CC(c2ccc(Cl)cc2)c2cccn2-c2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C21H16ClNO3/c22-14-5-3-13(4-6-14)15-10-19(24)16-11-20-21(26-9-8-25-20)12-18(16)23-7-1-2-17(15)23/h1-7,11-12,15H,8-10H2 |
| InChIKey | AZZQCAILELBFOK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |