C24H22N2O7S — CID 133179570
methyl 2-[[4-(9-oxo-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-7-yl)phenyl]sulfamoyl]acetate (PubChem CID 133179570) has the molecular formula C24H22N2O7S and a molecular weight of 482.51 g/mol. Its IUPAC name is methyl 2-[[4-(9-oxo-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-7-yl)phenyl]sulfamoyl]acetate.
| Compound Name | methyl 2-[[4-(9-oxo-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-7-yl)phenyl]sulfamoyl]acetate |
|---|---|
| PubChem CID | 133179570 |
| Molecular Formula | C24H22N2O7S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | methyl 2-[[4-(9-oxo-13,16-dioxa-2-azatetracyclo[8.8.0.02,6.012,17]octadeca-1(18),3,5,10,12(17)-pentaen-7-yl)phenyl]sulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)Nc1ccc(C2CC(=O)c3cc4c(cc3-n3cccc32)OCCO4)cc1 |
| InChI | InChI=1S/C24H22N2O7S/c1-31-24(28)14-34(29,30)25-16-6-4-15(5-7-16)17-11-21(27)18-12-22-23(33-10-9-32-22)13-20(18)26-8-2-3-19(17)26/h2-8,12-13,17,25H,9-11,14H2,1H3 |
| InChIKey | UZLYPLFNMJYPSG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |