C15H10ClFO — CID 129405671
(3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydroinden-1-one (PubChem CID 129405671) has the molecular formula C15H10ClFO and a molecular weight of 260.70 g/mol. Its IUPAC name is (3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydroinden-1-one.
| Compound Name | (3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 129405671 |
| Molecular Formula | C15H10ClFO |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (3S)-3-(3-chloro-4-fluorophenyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1C[C@@H](c2ccc(F)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C15H10ClFO/c16-13-7-9(5-6-14(13)17)12-8-15(18)11-4-2-1-3-10(11)12/h1-7,12H,8H2/t12-/m0/s1 |
| InChIKey | ZVOFQLRWMFJKCN-LBPRGKRZSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |